C24H28N4O8S — CID 4840619
[2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate (PubChem CID 4840619) has the molecular formula C24H28N4O8S and a molecular weight of 532.58 g/mol. Its IUPAC name is [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate.
| Compound Name | [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 4840619 |
| Molecular Formula | C24H28N4O8S |
| Molecular Weight | 532.58 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | [2-[3-(azepan-1-ylsulfonyl)-4-methylanilino]-2-oxoethyl] 2-[(3-nitrobenzoyl)amino]acetate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CNC(=O)c2cccc([N+](=O)[O-])c2)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C24H28N4O8S/c1-17-9-10-19(14-21(17)37(34,35)27-11-4-2-3-5-12-27)26-22(29)16-36-23(30)15-25-24(31)18-7-6-8-20(13-18)28(32)33/h6-10,13-14H,2-5,11-12,15-16H2,1H3,(H,25,31)(H,26,29) |
| InChIKey | GAGHEUKNXRQNDJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 165.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|