C17H16ClN3O4 — CID 9164655
N-[2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 9164655) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is N-[2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9164655 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-[2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | C[C@H](NC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClN3O4/c1-11(12-4-2-6-14(18)8-12)20-16(22)10-19-17(23)13-5-3-7-15(9-13)21(24)25/h2-9,11H,10H2,1H3,(H,19,23)(H,20,22)/t11-/m0/s1 |
| InChIKey | IYGQXDAUGHOYIM-NSHDSACASA-N |
| XLogP | 2.86 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|