C19H21ClN2O4 — CID 51163512
N-[2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl]-3,4-dimethoxybenzamide (PubChem CID 51163512) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is N-[2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 51163512 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[2-[1-(3-chlorophenyl)ethylamino]-2-oxoethyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NC(C)c2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C19H21ClN2O4/c1-12(13-5-4-6-15(20)9-13)22-18(23)11-21-19(24)14-7-8-16(25-2)17(10-14)26-3/h4-10,12H,11H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | FTVPWWPPTQIFHQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |