C18H17F2N3O5 — CID 46476803
N-[2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]-3-nitrobenzamide (PubChem CID 46476803) has the molecular formula C18H17F2N3O5 and a molecular weight of 393.35 g/mol. Its IUPAC name is N-[2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N-[2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 46476803 |
| Molecular Formula | C18H17F2N3O5 |
| Molecular Weight | 393.35 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[2-[1-[3-(difluoromethoxy)phenyl]ethylamino]-2-oxoethyl]-3-nitrobenzamide |
| SMILES | CC(NC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)c1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C18H17F2N3O5/c1-11(12-4-3-7-15(9-12)28-18(19)20)22-16(24)10-21-17(25)13-5-2-6-14(8-13)23(26)27/h2-9,11,18H,10H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | RDGZONNFJSISBM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|