C21H23N3O4 — CID 9395601
3-nitro-N-[2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl]benzamide (PubChem CID 9395601) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 3-nitro-N-[2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl]benzamide.
| Compound Name | 3-nitro-N-[2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 9395601 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-nitro-N-[2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl]benzamide |
| SMILES | C[C@H](NC(=O)CNC(=O)c1cccc([N+](=O)[O-])c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C21H23N3O4/c1-14(16-10-9-15-5-2-3-6-17(15)11-16)23-20(25)13-22-21(26)18-7-4-8-19(12-18)24(27)28/h4,7-12,14H,2-3,5-6,13H2,1H3,(H,22,26)(H,23,25)/t14-/m0/s1 |
| InChIKey | OBKSCOLNONFBSC-AWEZNQCLSA-N |
| XLogP | 3.08 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|