C15H24N2O2S — CID 60729978
N-(4-acetyl-1,3-thiazol-2-yl)decanamide (PubChem CID 60729978) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is N-(4-acetyl-1,3-thiazol-2-yl)decanamide.
| Compound Name | N-(4-acetyl-1,3-thiazol-2-yl)decanamide |
|---|---|
| PubChem CID | 60729978 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | N-(4-acetyl-1,3-thiazol-2-yl)decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1nc(C(C)=O)cs1 |
| InChI | InChI=1S/C15H24N2O2S/c1-3-4-5-6-7-8-9-10-14(19)17-15-16-13(11-20-15)12(2)18/h11H,3-10H2,1-2H3,(H,16,17,19) |
| InChIKey | NNDARJVBTCFQNO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|