C19H25ClN2OS — CID 4302943
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]decanamide (PubChem CID 4302943) has the molecular formula C19H25ClN2OS and a molecular weight of 364.94 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]decanamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]decanamide |
|---|---|
| PubChem CID | 4302943 |
| Molecular Formula | C19H25ClN2OS |
| Molecular Weight | 364.94 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C19H25ClN2OS/c1-2-3-4-5-6-7-8-9-18(23)22-19-21-17(14-24-19)15-10-12-16(20)13-11-15/h10-14H,2-9H2,1H3,(H,21,22,23) |
| InChIKey | FQVIHQVXHWADHD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.94 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|