C18H22ClN3O2S — CID 56521362
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide (PubChem CID 56521362) has the molecular formula C18H22ClN3O2S and a molecular weight of 379.91 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide |
|---|---|
| PubChem CID | 56521362 |
| Molecular Formula | C18H22ClN3O2S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide |
| SMILES | CCN(CC)C(=O)CCCC(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C18H22ClN3O2S/c1-3-22(4-2)17(24)7-5-6-16(23)21-18-20-15(12-25-18)13-8-10-14(19)11-9-13/h8-12H,3-7H2,1-2H3,(H,20,21,23) |
| InChIKey | MXKULJHHSCMILK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |