C20H27N3O3S — CID 56521249
N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide (PubChem CID 56521249) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide |
|---|---|
| PubChem CID | 56521249 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-1,3-thiazol-2-yl]-N',N'-diethylpentanediamide |
| SMILES | CCOc1ccc(-c2csc(NC(=O)CCCC(=O)N(CC)CC)n2)cc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-4-23(5-2)19(25)9-7-8-18(24)22-20-21-17(14-27-20)15-10-12-16(13-11-15)26-6-3/h10-14H,4-9H2,1-3H3,(H,21,22,24) |
| InChIKey | NXCSCRQNSCZSOO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |