C31H36N4O2S2 — CID 4582028
N,N'-bis[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]pentanediamide (PubChem CID 4582028) has the molecular formula C31H36N4O2S2 and a molecular weight of 560.79 g/mol. Its IUPAC name is N,N'-bis[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]pentanediamide.
| Compound Name | N,N'-bis[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]pentanediamide |
|---|---|
| PubChem CID | 4582028 |
| Molecular Formula | C31H36N4O2S2 |
| Molecular Weight | 560.79 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | N,N'-bis[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]pentanediamide |
| SMILES | CCC(C)c1ccc(-c2csc(NC(=O)CCCC(=O)Nc3nc(-c4ccc(C(C)CC)cc4)cs3)n2)cc1 |
| InChI | InChI=1S/C31H36N4O2S2/c1-5-20(3)22-10-14-24(15-11-22)26-18-38-30(32-26)34-28(36)8-7-9-29(37)35-31-33-27(19-39-31)25-16-12-23(13-17-25)21(4)6-2/h10-21H,5-9H2,1-4H3,(H,32,34,36)(H,33,35,37) |
| InChIKey | UMQDIPOAWQWTIP-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.79 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |