C17H21ClN2OS — CID 4129995
N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-4-chlorobutanamide (PubChem CID 4129995) has the molecular formula C17H21ClN2OS and a molecular weight of 336.89 g/mol. Its IUPAC name is N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-4-chlorobutanamide.
| Compound Name | N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-4-chlorobutanamide |
|---|---|
| PubChem CID | 4129995 |
| Molecular Formula | C17H21ClN2OS |
| Molecular Weight | 336.89 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[4-(4-butan-2-ylphenyl)-1,3-thiazol-2-yl]-4-chlorobutanamide |
| SMILES | CCC(C)c1ccc(-c2csc(NC(=O)CCCCl)n2)cc1 |
| InChI | InChI=1S/C17H21ClN2OS/c1-3-12(2)13-6-8-14(9-7-13)15-11-22-17(19-15)20-16(21)5-4-10-18/h6-9,11-12H,3-5,10H2,1-2H3,(H,19,20,21) |
| InChIKey | ARXKSMBZKDOIFJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.89 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|