C18H21N2O3S- — CID 6974874
5-[[4-[4-[(2S)-butan-2-yl]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoate (PubChem CID 6974874) has the molecular formula C18H21N2O3S- and a molecular weight of 345.44 g/mol. Its IUPAC name is 5-[[4-[4-[(2S)-butan-2-yl]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoate.
| Compound Name | 5-[[4-[4-[(2S)-butan-2-yl]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 6974874 |
| Molecular Formula | C18H21N2O3S- |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 5-[[4-[4-[(2S)-butan-2-yl]phenyl]-1,3-thiazol-2-yl]amino]-5-oxopentanoate |
| SMILES | CC[C@H](C)c1ccc(-c2csc(NC(=O)CCCC(=O)[O-])n2)cc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-3-12(2)13-7-9-14(10-8-13)15-11-24-18(19-15)20-16(21)5-4-6-17(22)23/h7-12H,3-6H2,1-2H3,(H,22,23)(H,19,20,21)/p-1/t12-/m0/s1 |
| InChIKey | AGILXBJREXFFKQ-LBPRGKRZSA-M |
| XLogP | 3.18 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |