C32H38N4O2S2 — CID 3376652
N,N'-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]hexanediamide (PubChem CID 3376652) has the molecular formula C32H38N4O2S2 and a molecular weight of 574.82 g/mol. Its IUPAC name is N,N'-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]hexanediamide.
| Compound Name | N,N'-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]hexanediamide |
|---|---|
| PubChem CID | 3376652 |
| Molecular Formula | C32H38N4O2S2 |
| Molecular Weight | 574.82 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | N,N'-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]hexanediamide |
| SMILES | CC(C)(C)c1ccc(-c2csc(NC(=O)CCCCC(=O)Nc3nc(-c4ccc(C(C)(C)C)cc4)cs3)n2)cc1 |
| InChI | InChI=1S/C32H38N4O2S2/c1-31(2,3)23-15-11-21(12-16-23)25-19-39-29(33-25)35-27(37)9-7-8-10-28(38)36-30-34-26(20-40-30)22-13-17-24(18-14-22)32(4,5)6/h11-20H,7-10H2,1-6H3,(H,33,35,37)(H,34,36,38) |
| InChIKey | IQMFFWKEPKHWAU-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.82 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|