C32H32N4O2S3 — CID 4295617
2-N,5-N-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide (PubChem CID 4295617) has the molecular formula C32H32N4O2S3 and a molecular weight of 600.84 g/mol. Its IUPAC name is 2-N,5-N-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 4295617 |
| Molecular Formula | C32H32N4O2S3 |
| Molecular Weight | 600.84 g/mol |
| Exact Mass | 600.17 |
| IUPAC Name | 2-N,5-N-bis[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]thiophene-2,5-dicarboxamide |
| SMILES | CC(C)(C)c1ccc(-c2csc(NC(=O)c3ccc(C(=O)Nc4nc(-c5ccc(C(C)(C)C)cc5)cs4)s3)n2)cc1 |
| InChI | InChI=1S/C32H32N4O2S3/c1-31(2,3)21-11-7-19(8-12-21)23-17-39-29(33-23)35-27(37)25-15-16-26(41-25)28(38)36-30-34-24(18-40-30)20-9-13-22(14-10-20)32(4,5)6/h7-18H,1-6H3,(H,33,35,37)(H,34,36,38) |
| InChIKey | ZECMYAKONOTTIB-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.84 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |