C23H26N2OS — CID 4120073
N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-4-propan-2-ylbenzamide (PubChem CID 4120073) has the molecular formula C23H26N2OS and a molecular weight of 378.54 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-4-propan-2-ylbenzamide.
| Compound Name | N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4120073 |
| Molecular Formula | C23H26N2OS |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)Nc2nc(-c3ccc(C(C)(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C23H26N2OS/c1-15(2)16-6-8-18(9-7-16)21(26)25-22-24-20(14-27-22)17-10-12-19(13-11-17)23(3,4)5/h6-15H,1-5H3,(H,24,25,26) |
| InChIKey | IWZUOYZUXQTQJV-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |