C32H30N4O2S2 — CID 3495731
1-N,3-N-bis[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide (PubChem CID 3495731) has the molecular formula C32H30N4O2S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 3495731 |
| Molecular Formula | C32H30N4O2S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 1-N,3-N-bis[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzene-1,3-dicarboxamide |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)c3cccc(C(=O)Nc4nc(-c5ccc(C(C)C)cc5)cs4)c3)n2)cc1 |
| InChI | InChI=1S/C32H30N4O2S2/c1-19(2)21-8-12-23(13-9-21)27-17-39-31(33-27)35-29(37)25-6-5-7-26(16-25)30(38)36-32-34-28(18-40-32)24-14-10-22(11-15-24)20(3)4/h5-20H,1-4H3,(H,33,35,37)(H,34,36,38) |
| InChIKey | WPFFMRVJNRVMSA-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |