C19H13F5N2OS — CID 4060927
2,3,4,5,6-pentafluoro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 4060927) has the molecular formula C19H13F5N2OS and a molecular weight of 412.38 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4060927 |
| Molecular Formula | C19H13F5N2OS |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[4-(4-propan-2-ylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | CC(C)c1ccc(-c2csc(NC(=O)c3c(F)c(F)c(F)c(F)c3F)n2)cc1 |
| InChI | InChI=1S/C19H13F5N2OS/c1-8(2)9-3-5-10(6-4-9)11-7-28-19(25-11)26-18(27)12-13(20)15(22)17(24)16(23)14(12)21/h3-8H,1-2H3,(H,25,26,27) |
| InChIKey | PWTQUULHNOJZJU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|