C18H24N2OS — CID 4232837
N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-methylbutanamide (PubChem CID 4232837) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-methylbutanamide.
| Compound Name | N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 4232837 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-[4-(4-tert-butylphenyl)-1,3-thiazol-2-yl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1nc(-c2ccc(C(C)(C)C)cc2)cs1 |
| InChI | InChI=1S/C18H24N2OS/c1-12(2)10-16(21)20-17-19-15(11-22-17)13-6-8-14(9-7-13)18(3,4)5/h6-9,11-12H,10H2,1-5H3,(H,19,20,21) |
| InChIKey | SJYSZKFJMHUBMZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |