C14H17N3OS2 — CID 119687624
3-amino-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 119687624) has the molecular formula C14H17N3OS2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-amino-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | 3-amino-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 119687624 |
| Molecular Formula | C14H17N3OS2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-amino-N-[4-(4-methylsulfanylphenyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CSc1ccc(-c2csc(NC(=O)CC(C)N)n2)cc1 |
| InChI | InChI=1S/C14H17N3OS2/c1-9(15)7-13(18)17-14-16-12(8-20-14)10-3-5-11(19-2)6-4-10/h3-6,8-9H,7,15H2,1-2H3,(H,16,17,18) |
| InChIKey | MGPJIUYCRPVEAU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |