C17H23N3O2S — CID 8962073
N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]phenyl]-3-methylbutanamide (PubChem CID 8962073) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 8962073 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]phenyl]-3-methylbutanamide |
| SMILES | COCCNc1nc(-c2ccc(NC(=O)CC(C)C)cc2)cs1 |
| InChI | InChI=1S/C17H23N3O2S/c1-12(2)10-16(21)19-14-6-4-13(5-7-14)15-11-23-17(20-15)18-8-9-22-3/h4-7,11-12H,8-10H2,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | QTIVQASGJMMIKU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|