C15H19N3O2S2 — CID 47061837
N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-2-methylsulfanylphenyl]acetamide (PubChem CID 47061837) has the molecular formula C15H19N3O2S2 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-2-methylsulfanylphenyl]acetamide.
| Compound Name | N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-2-methylsulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 47061837 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-[4-[2-(2-methoxyethylamino)-1,3-thiazol-4-yl]-2-methylsulfanylphenyl]acetamide |
| SMILES | COCCNc1nc(-c2ccc(NC(C)=O)c(SC)c2)cs1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-10(19)17-12-5-4-11(8-14(12)21-3)13-9-22-15(18-13)16-6-7-20-2/h4-5,8-9H,6-7H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | RJHOTFYOMTZTGM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|