C20H19ClN4O5S — CID 16963342
N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide (PubChem CID 16963342) has the molecular formula C20H19ClN4O5S and a molecular weight of 462.92 g/mol. Its IUPAC name is N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide.
| Compound Name | N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963342 |
| Molecular Formula | C20H19ClN4O5S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)Nc1nc(-c2ccc(OC)c(Cl)c2)cs1 |
| InChI | InChI=1S/C20H19ClN4O5S/c1-29-8-7-22-16-5-4-13(25(27)28)10-14(16)19(26)24-20-23-17(11-31-20)12-3-6-18(30-2)15(21)9-12/h3-6,9-11,22H,7-8H2,1-2H3,(H,23,24,26) |
| InChIKey | XOOUHQKTDYULHE-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|