C20H19BrN4O4S — CID 16963292
N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide (PubChem CID 16963292) has the molecular formula C20H19BrN4O4S and a molecular weight of 491.37 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide.
| Compound Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963292 |
| Molecular Formula | C20H19BrN4O4S |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | N-[4-(4-bromophenyl)-5-methyl-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)Nc1nc(-c2ccc(Br)cc2)c(C)s1 |
| InChI | InChI=1S/C20H19BrN4O4S/c1-12-18(13-3-5-14(21)6-4-13)23-20(30-12)24-19(26)16-11-15(25(27)28)7-8-17(16)22-9-10-29-2/h3-8,11,22H,9-10H2,1-2H3,(H,23,24,26) |
| InChIKey | VGWJBVDTYMSNOH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|