C19H16F2N4O4S — CID 16963254
N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide (PubChem CID 16963254) has the molecular formula C19H16F2N4O4S and a molecular weight of 434.42 g/mol. Its IUPAC name is N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide.
| Compound Name | N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963254 |
| Molecular Formula | C19H16F2N4O4S |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[4-(2,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-methoxyethylamino)-5-nitrobenzamide |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)Nc1nc(-c2cc(F)ccc2F)cs1 |
| InChI | InChI=1S/C19H16F2N4O4S/c1-29-7-6-22-16-5-3-12(25(27)28)9-14(16)18(26)24-19-23-17(10-30-19)13-8-11(20)2-4-15(13)21/h2-5,8-10,22H,6-7H2,1H3,(H,23,24,26) |
| InChIKey | RVFHFZXDOBZKCU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|