C18H18N4O4S2 — CID 16963205
2-(2-methoxyethylamino)-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-5-nitrobenzamide (PubChem CID 16963205) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-5-nitrobenzamide.
| Compound Name | 2-(2-methoxyethylamino)-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 16963205 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-(2-methylsulfanyl-1,3-benzothiazol-6-yl)-5-nitrobenzamide |
| SMILES | COCCNc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc2nc(SC)sc2c1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-26-8-7-19-14-6-4-12(22(24)25)10-13(14)17(23)20-11-3-5-15-16(9-11)28-18(21-15)27-2/h3-6,9-10,19H,7-8H2,1-2H3,(H,20,23) |
| InChIKey | GWLNRKZBSQZZFS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|