C17H11BrClN3O4S — CID 16797086
4-bromo-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide (PubChem CID 16797086) has the molecular formula C17H11BrClN3O4S and a molecular weight of 468.72 g/mol. Its IUPAC name is 4-bromo-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide.
| Compound Name | 4-bromo-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 16797086 |
| Molecular Formula | C17H11BrClN3O4S |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | 4-bromo-N-[4-(3-chloro-4-methoxyphenyl)-1,3-thiazol-2-yl]-3-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(NC(=O)c3ccc(Br)c([N+](=O)[O-])c3)n2)cc1Cl |
| InChI | InChI=1S/C17H11BrClN3O4S/c1-26-15-5-3-9(6-12(15)19)13-8-27-17(20-13)21-16(23)10-2-4-11(18)14(7-10)22(24)25/h2-8H,1H3,(H,20,21,23) |
| InChIKey | NKABKWCFJNXBCE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|