C11H13N3OS — CID 62941456
N-(2-methoxyethyl)-4-pyridin-4-yl-1,3-thiazol-2-amine (PubChem CID 62941456) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is N-(2-methoxyethyl)-4-pyridin-4-yl-1,3-thiazol-2-amine.
| Compound Name | N-(2-methoxyethyl)-4-pyridin-4-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62941456 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-(2-methoxyethyl)-4-pyridin-4-yl-1,3-thiazol-2-amine |
| SMILES | COCCNc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C11H13N3OS/c1-15-7-6-13-11-14-10(8-16-11)9-2-4-12-5-3-9/h2-5,8H,6-7H2,1H3,(H,13,14) |
| InChIKey | UXIPNERSEZVMNB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|