C13H16N4O — CID 20550365
2-N-(2-methoxyethyl)-6-pyridin-4-ylpyridine-2,3-diamine (PubChem CID 20550365) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-6-pyridin-4-ylpyridine-2,3-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-6-pyridin-4-ylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 20550365 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 2-N-(2-methoxyethyl)-6-pyridin-4-ylpyridine-2,3-diamine |
| SMILES | COCCNc1nc(-c2ccncc2)ccc1N |
| InChI | InChI=1S/C13H16N4O/c1-18-9-8-16-13-11(14)2-3-12(17-13)10-4-6-15-7-5-10/h2-7H,8-9,14H2,1H3,(H,16,17) |
| InChIKey | SXFAJAUKVUNXRO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|