C8H12ClN3O — CID 79021487
5-chloro-2-N-(2-methoxyethyl)pyridine-2,3-diamine (PubChem CID 79021487) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 5-chloro-2-N-(2-methoxyethyl)pyridine-2,3-diamine.
| Compound Name | 5-chloro-2-N-(2-methoxyethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 79021487 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 5-chloro-2-N-(2-methoxyethyl)pyridine-2,3-diamine |
| SMILES | COCCNc1ncc(Cl)cc1N |
| InChI | InChI=1S/C8H12ClN3O/c1-13-3-2-11-8-7(10)4-6(9)5-12-8/h4-5H,2-3,10H2,1H3,(H,11,12) |
| InChIKey | CJXHUTLDRDHFNP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|