C10H15BrClN3O — CID 114836386
N'-(3-bromo-5-chloro-2-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 114836386) has the molecular formula C10H15BrClN3O and a molecular weight of 308.61 g/mol. Its IUPAC name is N'-(3-bromo-5-chloro-2-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | N'-(3-bromo-5-chloro-2-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 114836386 |
| Molecular Formula | C10H15BrClN3O |
| Molecular Weight | 308.61 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | N'-(3-bromo-5-chloro-2-pyridinyl)-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | COCCNCCNc1ncc(Cl)cc1Br |
| InChI | InChI=1S/C10H15BrClN3O/c1-16-5-4-13-2-3-14-10-9(11)6-8(12)7-15-10/h6-7,13H,2-5H2,1H3,(H,14,15) |
| InChIKey | SFSHOTZAFVMVMP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.61 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|