C15H15BrClN3O — CID 114835711
N-[2-[(3-bromo-5-chloro-2-pyridinyl)amino]ethyl]-4-methylbenzamide (PubChem CID 114835711) has the molecular formula C15H15BrClN3O and a molecular weight of 368.66 g/mol. Its IUPAC name is N-[2-[(3-bromo-5-chloro-2-pyridinyl)amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[(3-bromo-5-chloro-2-pyridinyl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 114835711 |
| Molecular Formula | C15H15BrClN3O |
| Molecular Weight | 368.66 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-[2-[(3-bromo-5-chloro-2-pyridinyl)amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2ncc(Cl)cc2Br)cc1 |
| InChI | InChI=1S/C15H15BrClN3O/c1-10-2-4-11(5-3-10)15(21)19-7-6-18-14-13(16)8-12(17)9-20-14/h2-5,8-9H,6-7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | FLDHWOSDMYLLJK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.66 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|