C11H16N4O2 — CID 103468093
5-amino-6-[2-(2-methoxyethoxy)ethylamino]pyridine-3-carbonitrile (PubChem CID 103468093) has the molecular formula C11H16N4O2 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-amino-6-[2-(2-methoxyethoxy)ethylamino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[2-(2-methoxyethoxy)ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468093 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 5-amino-6-[2-(2-methoxyethoxy)ethylamino]pyridine-3-carbonitrile |
| SMILES | COCCOCCNc1ncc(C#N)cc1N |
| InChI | InChI=1S/C11H16N4O2/c1-16-4-5-17-3-2-14-11-10(13)6-9(7-12)8-15-11/h6,8H,2-5,13H2,1H3,(H,14,15) |
| InChIKey | APSIPMMZNMPAMR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|