C12H18N4 — CID 103469344
5-amino-6-(2,2-dimethylbutylamino)pyridine-3-carbonitrile (PubChem CID 103469344) has the molecular formula C12H18N4 and a molecular weight of 218.30 g/mol. Its IUPAC name is 5-amino-6-(2,2-dimethylbutylamino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-(2,2-dimethylbutylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103469344 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 5-amino-6-(2,2-dimethylbutylamino)pyridine-3-carbonitrile |
| SMILES | CCC(C)(C)CNc1ncc(C#N)cc1N |
| InChI | InChI=1S/C12H18N4/c1-4-12(2,3)8-16-11-10(14)5-9(6-13)7-15-11/h5,7H,4,8,14H2,1-3H3,(H,15,16) |
| InChIKey | KETNJMIGGXLLON-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |