C11H12N6 — CID 103468425
5-amino-6-[(1-methylimidazol-2-yl)methylamino]pyridine-3-carbonitrile (PubChem CID 103468425) has the molecular formula C11H12N6 and a molecular weight of 228.26 g/mol. Its IUPAC name is 5-amino-6-[(1-methylimidazol-2-yl)methylamino]pyridine-3-carbonitrile.
| Compound Name | 5-amino-6-[(1-methylimidazol-2-yl)methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103468425 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 5-amino-6-[(1-methylimidazol-2-yl)methylamino]pyridine-3-carbonitrile |
| SMILES | Cn1ccnc1CNc1ncc(C#N)cc1N |
| InChI | InChI=1S/C11H12N6/c1-17-3-2-14-10(17)7-16-11-9(13)4-8(5-12)6-15-11/h2-4,6H,7,13H2,1H3,(H,15,16) |
| InChIKey | QNIMAGZYXMPSCK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |