C10H10N6 — CID 63239072
3-[(1-methylimidazol-2-yl)methylamino]pyrazine-2-carbonitrile (PubChem CID 63239072) has the molecular formula C10H10N6 and a molecular weight of 214.23 g/mol. Its IUPAC name is 3-[(1-methylimidazol-2-yl)methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[(1-methylimidazol-2-yl)methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 63239072 |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-[(1-methylimidazol-2-yl)methylamino]pyrazine-2-carbonitrile |
| SMILES | Cn1ccnc1CNc1nccnc1C#N |
| InChI | InChI=1S/C10H10N6/c1-16-5-4-13-9(16)7-15-10-8(6-11)12-2-3-14-10/h2-5H,7H2,1H3,(H,14,15) |
| InChIKey | MVEZQYDQNQUSCY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |