C18H22N6 — CID 133283250
3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazine-2-carbonitrile (PubChem CID 133283250) has the molecular formula C18H22N6 and a molecular weight of 322.42 g/mol. Its IUPAC name is 3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133283250 |
| Molecular Formula | C18H22N6 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 3-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methylamino]pyrazine-2-carbonitrile |
| SMILES | CN1CCN(Cc2ccc(CNc3nccnc3C#N)cc2)CC1 |
| InChI | InChI=1S/C18H22N6/c1-23-8-10-24(11-9-23)14-16-4-2-15(3-5-16)13-22-18-17(12-19)20-6-7-21-18/h2-7H,8-11,13-14H2,1H3,(H,21,22) |
| InChIKey | YFLYCVKZEWSABB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |