C13H15N5 — CID 62895253
3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]pyridine-2-carbonitrile (PubChem CID 62895253) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62895253 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]pyridine-2-carbonitrile |
| SMILES | Cn1ccnc1CCNCc1cccnc1C#N |
| InChI | InChI=1S/C13H15N5/c1-18-8-7-17-13(18)4-6-15-10-11-3-2-5-16-12(11)9-14/h2-3,5,7-8,15H,4,6,10H2,1H3 |
| InChIKey | ZRFCEYOZOVMWPT-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|