C12H16N4 — CID 61214868
2-(1-methylimidazol-2-yl)-N-(pyridin-3-ylmethyl)ethanamine (PubChem CID 61214868) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-N-(pyridin-3-ylmethyl)ethanamine.
| Compound Name | 2-(1-methylimidazol-2-yl)-N-(pyridin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 61214868 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-N-(pyridin-3-ylmethyl)ethanamine |
| SMILES | Cn1ccnc1CCNCc1cccnc1 |
| InChI | InChI=1S/C12H16N4/c1-16-8-7-15-12(16)4-6-14-10-11-3-2-5-13-9-11/h2-3,5,7-9,14H,4,6,10H2,1H3 |
| InChIKey | PQDHQMURERWWQF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|