C17H26N4 — CID 61214429
N,N-diethyl-4-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]aniline (PubChem CID 61214429) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is N,N-diethyl-4-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]aniline.
| Compound Name | N,N-diethyl-4-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]aniline |
|---|---|
| PubChem CID | 61214429 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | N,N-diethyl-4-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]aniline |
| SMILES | CCN(CC)c1ccc(CNCCc2nccn2C)cc1 |
| InChI | InChI=1S/C17H26N4/c1-4-21(5-2)16-8-6-15(7-9-16)14-18-11-10-17-19-12-13-20(17)3/h6-9,12-13,18H,4-5,10-11,14H2,1-3H3 |
| InChIKey | NXSVMWDFUULKAE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|