C16H25N3Si — CID 103437741
2-(1-methylimidazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine (PubChem CID 103437741) has the molecular formula C16H25N3Si and a molecular weight of 287.48 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine.
| Compound Name | 2-(1-methylimidazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103437741 |
| Molecular Formula | C16H25N3Si |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-N-[(4-trimethylsilylphenyl)methyl]ethanamine |
| SMILES | Cn1ccnc1CCNCc1ccc([Si](C)(C)C)cc1 |
| InChI | InChI=1S/C16H25N3Si/c1-19-12-11-18-16(19)9-10-17-13-14-5-7-15(8-6-14)20(2,3)4/h5-8,11-12,17H,9-10,13H2,1-4H3 |
| InChIKey | WSCRSGYXIHYNQO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|