C14H18N4O — CID 55136863
3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]benzamide (PubChem CID 55136863) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is 3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]benzamide.
| Compound Name | 3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]benzamide |
|---|---|
| PubChem CID | 55136863 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-[[2-(1-methylimidazol-2-yl)ethylamino]methyl]benzamide |
| SMILES | Cn1ccnc1CCNCc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C14H18N4O/c1-18-8-7-17-13(18)5-6-16-10-11-3-2-4-12(9-11)14(15)19/h2-4,7-9,16H,5-6,10H2,1H3,(H2,15,19) |
| InChIKey | CJXWTNBAEIXTAX-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|