C13H16N4O — CID 61462987
3-[(2-pyrazol-1-ylethylamino)methyl]benzamide (PubChem CID 61462987) has the molecular formula C13H16N4O and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-[(2-pyrazol-1-ylethylamino)methyl]benzamide.
| Compound Name | 3-[(2-pyrazol-1-ylethylamino)methyl]benzamide |
|---|---|
| PubChem CID | 61462987 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-[(2-pyrazol-1-ylethylamino)methyl]benzamide |
| SMILES | NC(=O)c1cccc(CNCCn2cccn2)c1 |
| InChI | InChI=1S/C13H16N4O/c14-13(18)12-4-1-3-11(9-12)10-15-6-8-17-7-2-5-16-17/h1-5,7,9,15H,6,8,10H2,(H2,14,18) |
| InChIKey | FJPQHIPOHGPAJS-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|