C10H13N3O2S — CID 62894530
3-[(2-methylsulfonylethylamino)methyl]pyridine-2-carbonitrile (PubChem CID 62894530) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 3-[(2-methylsulfonylethylamino)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(2-methylsulfonylethylamino)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62894530 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 3-[(2-methylsulfonylethylamino)methyl]pyridine-2-carbonitrile |
| SMILES | CS(=O)(=O)CCNCc1cccnc1C#N |
| InChI | InChI=1S/C10H13N3O2S/c1-16(14,15)6-5-12-8-9-3-2-4-13-10(9)7-11/h2-4,12H,5-6,8H2,1H3 |
| InChIKey | MTBWDLJSQSIUOX-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|