C14H19N3 — CID 62893680
3-[(2-cyclopentylethylamino)methyl]pyridine-2-carbonitrile (PubChem CID 62893680) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 3-[(2-cyclopentylethylamino)methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[(2-cyclopentylethylamino)methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62893680 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 3-[(2-cyclopentylethylamino)methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CNCCC1CCCC1 |
| InChI | InChI=1S/C14H19N3/c15-10-14-13(6-3-8-17-14)11-16-9-7-12-4-1-2-5-12/h3,6,8,12,16H,1-2,4-5,7,9,11H2 |
| InChIKey | JOARPAVSPXIFLF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|