C15H14FN3 — CID 62895527
3-[[2-(2-fluorophenyl)ethylamino]methyl]pyridine-2-carbonitrile (PubChem CID 62895527) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 3-[[2-(2-fluorophenyl)ethylamino]methyl]pyridine-2-carbonitrile.
| Compound Name | 3-[[2-(2-fluorophenyl)ethylamino]methyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 62895527 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-[[2-(2-fluorophenyl)ethylamino]methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ncccc1CNCCc1ccccc1F |
| InChI | InChI=1S/C15H14FN3/c16-14-6-2-1-4-12(14)7-9-18-11-13-5-3-8-19-15(13)10-17/h1-6,8,18H,7,9,11H2 |
| InChIKey | YILHRYCPTBZSPB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|