C14H12FN5S — CID 19703623
1-(3-cyanopyrazin-2-yl)-3-[2-(2-fluorophenyl)ethyl]thiourea (PubChem CID 19703623) has the molecular formula C14H12FN5S and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(3-cyanopyrazin-2-yl)-3-[2-(2-fluorophenyl)ethyl]thiourea.
| Compound Name | 1-(3-cyanopyrazin-2-yl)-3-[2-(2-fluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19703623 |
| Molecular Formula | C14H12FN5S |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1-(3-cyanopyrazin-2-yl)-3-[2-(2-fluorophenyl)ethyl]thiourea |
| SMILES | N#Cc1nccnc1NC(=S)NCCc1ccccc1F |
| InChI | InChI=1S/C14H12FN5S/c15-11-4-2-1-3-10(11)5-6-19-14(21)20-13-12(9-16)17-7-8-18-13/h1-4,7-8H,5-6H2,(H2,18,19,20,21) |
| InChIKey | ZVWJWJQOWLOOLF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|