C13H10BrFN4 — CID 133284298
3-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrazine-2-carbonitrile (PubChem CID 133284298) has the molecular formula C13H10BrFN4 and a molecular weight of 321.15 g/mol. Its IUPAC name is 3-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133284298 |
| Molecular Formula | C13H10BrFN4 |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 3-[2-(5-bromo-2-fluorophenyl)ethylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCc1cc(Br)ccc1F |
| InChI | InChI=1S/C13H10BrFN4/c14-10-1-2-11(15)9(7-10)3-4-18-13-12(8-16)17-5-6-19-13/h1-2,5-7H,3-4H2,(H,18,19) |
| InChIKey | NHXDCOVIDNMLBF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |