C12H11N5 — CID 62671465
3-(2-pyridin-4-ylethylamino)pyrazine-2-carbonitrile (PubChem CID 62671465) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is 3-(2-pyridin-4-ylethylamino)pyrazine-2-carbonitrile.
| Compound Name | 3-(2-pyridin-4-ylethylamino)pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 62671465 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 3-(2-pyridin-4-ylethylamino)pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCCc1ccncc1 |
| InChI | InChI=1S/C12H11N5/c13-9-11-12(17-8-7-15-11)16-6-3-10-1-4-14-5-2-10/h1-2,4-5,7-8H,3,6H2,(H,16,17) |
| InChIKey | GBPLVHKTRHAIIL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |