C13H13N5O2S — CID 60620125
4-[2-[(3-cyanopyrazin-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 60620125) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 4-[2-[(3-cyanopyrazin-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(3-cyanopyrazin-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60620125 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-[2-[(3-cyanopyrazin-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | N#Cc1nccnc1NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H13N5O2S/c14-9-12-13(18-8-7-16-12)17-6-5-10-1-3-11(4-2-10)21(15,19)20/h1-4,7-8H,5-6H2,(H,17,18)(H2,15,19,20) |
| InChIKey | YCWNOTNNBAHENJ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |