C14H14N4O2S — CID 79834241
4-[2-[(6-cyano-3-pyridinyl)amino]ethyl]benzenesulfonamide (PubChem CID 79834241) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is 4-[2-[(6-cyano-3-pyridinyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 4-[2-[(6-cyano-3-pyridinyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79834241 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-[2-[(6-cyano-3-pyridinyl)amino]ethyl]benzenesulfonamide |
| SMILES | N#Cc1ccc(NCCc2ccc(S(N)(=O)=O)cc2)cn1 |
| InChI | InChI=1S/C14H14N4O2S/c15-9-12-3-4-13(10-18-12)17-8-7-11-1-5-14(6-2-11)21(16,19)20/h1-6,10,17H,7-8H2,(H2,16,19,20) |
| InChIKey | OZIXJHQMTNHIPV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |